C23H25N3O8S2 — CID 5050790
methyl 2-[[2-[[5-(2,6-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5050790) has the molecular formula C23H25N3O8S2 and a molecular weight of 535.60 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(2,6-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(2,6-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5050790 |
| Molecular Formula | C23H25N3O8S2 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | methyl 2-[[2-[[5-(2,6-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CS(=O)(=O)c2nnc(-c3c(OC)cccc3OC)o2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C23H25N3O8S2/c1-12-8-9-13-16(10-12)35-21(18(13)22(28)33-4)24-17(27)11-36(29,30)23-26-25-20(34-23)19-14(31-2)6-5-7-15(19)32-3/h5-7,12H,8-11H2,1-4H3,(H,24,27) |
| InChIKey | DPJOMRIHVMWBJC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |