C17H21FN4O3 — CID 4137677
7-(3,5-dimethylpiperazin-1-yl)-1-ethyl-6-fluoro-3-nitroquinolin-4-one (PubChem CID 4137677) has the molecular formula C17H21FN4O3 and a molecular weight of 348.38 g/mol. Its IUPAC name is 7-(3,5-dimethylpiperazin-1-yl)-1-ethyl-6-fluoro-3-nitroquinolin-4-one.
| Compound Name | 7-(3,5-dimethylpiperazin-1-yl)-1-ethyl-6-fluoro-3-nitroquinolin-4-one |
|---|---|
| PubChem CID | 4137677 |
| Molecular Formula | C17H21FN4O3 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 7-(3,5-dimethylpiperazin-1-yl)-1-ethyl-6-fluoro-3-nitroquinolin-4-one |
| SMILES | CCn1cc([N+](=O)[O-])c(=O)c2cc(F)c(N3CC(C)NC(C)C3)cc21 |
| InChI | InChI=1S/C17H21FN4O3/c1-4-20-9-16(22(24)25)17(23)12-5-13(18)15(6-14(12)20)21-7-10(2)19-11(3)8-21/h5-6,9-11,19H,4,7-8H2,1-3H3 |
| InChIKey | DMJRIWIYFASLJV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|