C15H14Cl2N4O3S — CID 41385208
(6S)-N-(2,5-dichlorophenyl)-4,4-dimethyl-3,8-dioxo-1-sulfanylidene-6,7-dihydropyrazolo[1,2-a][1,2,4]triazine-6-carboxamide (PubChem CID 41385208) has the molecular formula C15H14Cl2N4O3S and a molecular weight of 401.28 g/mol. Its IUPAC name is (6S)-N-(2,5-dichlorophenyl)-4,4-dimethyl-3,8-dioxo-1-sulfanylidene-6,7-dihydropyrazolo[1,2-a][1,2,4]triazine-6-carboxamide.
| Compound Name | (6S)-N-(2,5-dichlorophenyl)-4,4-dimethyl-3,8-dioxo-1-sulfanylidene-6,7-dihydropyrazolo[1,2-a][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 41385208 |
| Molecular Formula | C15H14Cl2N4O3S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | (6S)-N-(2,5-dichlorophenyl)-4,4-dimethyl-3,8-dioxo-1-sulfanylidene-6,7-dihydropyrazolo[1,2-a][1,2,4]triazine-6-carboxamide |
| SMILES | CC1(C)C(=O)NC(=S)N2C(=O)C[C@@H](C(=O)Nc3cc(Cl)ccc3Cl)N21 |
| InChI | InChI=1S/C15H14Cl2N4O3S/c1-15(2)13(24)19-14(25)20-11(22)6-10(21(15)20)12(23)18-9-5-7(16)3-4-8(9)17/h3-5,10H,6H2,1-2H3,(H,18,23)(H,19,24,25)/t10-/m0/s1 |
| InChIKey | RYMZDGMYCCCLQC-JTQLQIEISA-N |
| XLogP | 1.94 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|