C21H31N — CID 41495401
(3S,5R)-3,5-dimethyl-N-[(2S)-2-phenylpropyl]adamantan-1-amine (PubChem CID 41495401) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (3S,5R)-3,5-dimethyl-N-[(2S)-2-phenylpropyl]adamantan-1-amine.
| Compound Name | (3S,5R)-3,5-dimethyl-N-[(2S)-2-phenylpropyl]adamantan-1-amine |
|---|---|
| PubChem CID | 41495401 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (3S,5R)-3,5-dimethyl-N-[(2S)-2-phenylpropyl]adamantan-1-amine |
| SMILES | C[C@H](CNC12CC3C[C@@](C)(C1)C[C@](C)(C3)C2)c1ccccc1 |
| InChI | InChI=1S/C21H31N/c1-16(18-7-5-4-6-8-18)12-22-21-11-17-9-19(2,14-21)13-20(3,10-17)15-21/h4-8,16-17,22H,9-15H2,1-3H3/t16-,17?,19-,20+,21?/m1/s1 |
| InChIKey | MANGNMBWVLYNFB-FBKSWBLFSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |