C22H14N4O5S2 — CID 4152164
2-(1,3-dioxoisoindol-2-yl)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 4152164) has the molecular formula C22H14N4O5S2 and a molecular weight of 478.51 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4152164 |
| Molecular Formula | C22H14N4O5S2 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | NS(=O)(=O)c1ccc2nc(NC(=O)c3ccccc3N3C(=O)c4ccccc4C3=O)sc2c1 |
| InChI | InChI=1S/C22H14N4O5S2/c23-33(30,31)12-9-10-16-18(11-12)32-22(24-16)25-19(27)15-7-3-4-8-17(15)26-20(28)13-5-1-2-6-14(13)21(26)29/h1-11H,(H2,23,30,31)(H,24,25,27) |
| InChIKey | UFAOXSFFTBZNBP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 139.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|