C29H36N4O3S — CID 4166658
N-[3-[5-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]propyl]acetamide (PubChem CID 4166658) has the molecular formula C29H36N4O3S and a molecular weight of 520.70 g/mol. Its IUPAC name is N-[3-[5-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[5-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 4166658 |
| Molecular Formula | C29H36N4O3S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | N-[3-[5-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]propyl]acetamide |
| SMILES | CCOc1ccc(-n2c(CCCNC(C)=O)nnc2SCC(=O)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C29H36N4O3S/c1-3-36-26-17-15-25(16-18-26)33-28(10-7-19-30-21(2)34)31-32-29(33)37-20-27(35)24-13-11-23(12-14-24)22-8-5-4-6-9-22/h11-18,22H,3-10,19-20H2,1-2H3,(H,30,34) |
| InChIKey | ZDYGYSRQRRWXIY-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|