C13H9N3O8S3 — CID 4169388
4,5-dihydroxy-3-(1,3-thiazol-2-yldiazenyl)naphthalene-2,7-disulfonic acid (PubChem CID 4169388) has the molecular formula C13H9N3O8S3 and a molecular weight of 431.43 g/mol. Its IUPAC name is 4,5-dihydroxy-3-(1,3-thiazol-2-yldiazenyl)naphthalene-2,7-disulfonic acid.
| Compound Name | 4,5-dihydroxy-3-(1,3-thiazol-2-yldiazenyl)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 4169388 |
| Molecular Formula | C13H9N3O8S3 |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | 4,5-dihydroxy-3-(1,3-thiazol-2-yldiazenyl)naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2c(O)c(/N=N/c3nccs3)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C13H9N3O8S3/c17-8-5-7(26(19,20)21)3-6-4-9(27(22,23)24)11(12(18)10(6)8)15-16-13-14-1-2-25-13/h1-5,17-18H,(H,19,20,21)(H,22,23,24)/b16-15+ |
| InChIKey | KHGPMRVVIQLMRE-FOCLMDBBSA-N |
| XLogP | 2.62 |
| TPSA | 186.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|