C30H19NO7 — CID 4184550
[2-(furan-2-yl)-4-oxochromen-3-yl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 4184550) has the molecular formula C30H19NO7 and a molecular weight of 505.48 g/mol. Its IUPAC name is [2-(furan-2-yl)-4-oxochromen-3-yl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | [2-(furan-2-yl)-4-oxochromen-3-yl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 4184550 |
| Molecular Formula | C30H19NO7 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | [2-(furan-2-yl)-4-oxochromen-3-yl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | O=C(Oc1c(-c2ccco2)oc2ccccc2c1=O)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H19NO7/c32-25-21-13-6-7-14-23(21)37-26(24-15-8-16-36-24)27(25)38-30(35)22(17-18-9-2-1-3-10-18)31-28(33)19-11-4-5-12-20(19)29(31)34/h1-16,22H,17H2 |
| InChIKey | JLLDUZBSZVWMCL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 107.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|