About (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate
(6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 98365118) has the molecular formula C39H25N3O4
and a molecular weight of 599.65 g/mol. Its IUPAC name is (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
Molecular Properties
| Compound Name | (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| PubChem CID | 98365118 |
| Molecular Formula | C39H25N3O4 |
| Molecular Weight | 599.65 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | O=C(Oc1c(-c2ccccc2)c2nc3ccccc3nc2c2ccccc12)[C@@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C39H25N3O4/c43-37-28-19-9-10-20-29(28)38(44)42(37)32(23-24-13-3-1-4-14-24)39(45)46-36-27-18-8-7-17-26(27)34-35(33(36)25-15-5-2-6-16-25)41-31-22-12-11-21-30(31)40-34/h1-22,32H,23H2/t32-/m1/s1 |
| InChIKey | KUTFEARALYPYCR-JGCGQSQUSA-N |
| XLogP | 7.42 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 599.65 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
The IUPAC name of (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (CID 98365118) is (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
What is the SMILES notation for (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
The canonical SMILES for (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate is O=C(Oc1c(-c2ccccc2)c2nc3ccccc3nc2c2ccccc12)[C@@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
The InChIKey is KUTFEARALYPYCR-JGCGQSQUSA-N. The full InChI is InChI=1S/C39H25N3O4/c43-37-28-19-9-10-20-29(28)38(44)42(37)32(23-24-13-3-1-4-14-24)39(45)46-36-27-18-8-7-17-26(27)34-35(33(36)25-15-5-2-6-16-25)41-31-22-12-11-21-30(31)40-34/h1-22,32H,23H2/t32-/m1/s1.
What are the key properties of (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
(6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate has a molecular weight of 599.65 g/mol, XLogP of 7.42, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-phenylbenzo[a]phenazin-5-yl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate is sourced from PubChem (CID 98365118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).