C22H21FN2O5S — CID 4185973
2-(4-ethoxycarbonylphenyl)imino-3-[2-(2-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxylic acid (PubChem CID 4185973) has the molecular formula C22H21FN2O5S and a molecular weight of 444.48 g/mol. Its IUPAC name is 2-(4-ethoxycarbonylphenyl)imino-3-[2-(2-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxylic acid.
| Compound Name | 2-(4-ethoxycarbonylphenyl)imino-3-[2-(2-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxylic acid |
|---|---|
| PubChem CID | 4185973 |
| Molecular Formula | C22H21FN2O5S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-(4-ethoxycarbonylphenyl)imino-3-[2-(2-fluorophenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxylic acid |
| SMILES | CCOC(=O)c1ccc(/N=C2\SC(C(=O)O)CC(=O)N2CCc2ccccc2F)cc1 |
| InChI | InChI=1S/C22H21FN2O5S/c1-2-30-21(29)15-7-9-16(10-8-15)24-22-25(19(26)13-18(31-22)20(27)28)12-11-14-5-3-4-6-17(14)23/h3-10,18H,2,11-13H2,1H3,(H,27,28)/b24-22- |
| InChIKey | OSWPRHJVGVINAC-GYHWCHFESA-N |
| XLogP | 3.65 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|