C19H16N4O5S — CID 4189184
N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-2-methyl-3,5-dinitrobenzamide (PubChem CID 4189184) has the molecular formula C19H16N4O5S and a molecular weight of 412.43 g/mol. Its IUPAC name is N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-2-methyl-3,5-dinitrobenzamide.
| Compound Name | N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-2-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4189184 |
| Molecular Formula | C19H16N4O5S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-2-methyl-3,5-dinitrobenzamide |
| SMILES | CCc1sc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2C)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H16N4O5S/c1-3-16-17(12-7-5-4-6-8-12)20-19(29-16)21-18(24)14-9-13(22(25)26)10-15(11(14)2)23(27)28/h4-10H,3H2,1-2H3,(H,20,21,24) |
| InChIKey | FGBHRJPIGHTMLS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|