C43H50F3N3O4 — CID 4190155
8-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 4190155) has the molecular formula C43H50F3N3O4 and a molecular weight of 729.88 g/mol. Its IUPAC name is 8-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 4190155 |
| Molecular Formula | C43H50F3N3O4 |
| Molecular Weight | 729.88 g/mol |
| Exact Mass | 729.38 |
| IUPAC Name | 8-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCC3(CC2)C(=O)NCN3c2ccccc2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C43H50F3N3O4/c1-29-8-7-18-40(2)37(17-19-42(40,53)27-48-22-20-41(21-23-48)39(52)47-28-49(41)33-11-4-3-5-12-33)35-16-14-30(24-34(50)15-13-29)25-36(35)38(51)31-9-6-10-32(26-31)43(44,45)46/h3-6,8-12,14,16,25-26,34,37,50,53H,7,13,15,17-24,27-28H2,1-2H3,(H,47,52) |
| InChIKey | QHDRBJDYFIIODF-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.88 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|