C24H20N2O5 — CID 42051789
(4S)-3'-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 42051789) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is (4S)-3'-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4S)-3'-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 42051789 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (4S)-3'-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@]2(CCOc3ccccc32)C(=O)N1Cc1cc(=O)oc2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C24H20N2O5/c27-21-12-16(17-10-14-4-3-5-15(14)11-20(17)31-21)13-26-22(28)24(25-23(26)29)8-9-30-19-7-2-1-6-18(19)24/h1-2,6-7,10-12H,3-5,8-9,13H2,(H,25,29)/t24-/m0/s1 |
| InChIKey | FZJNFZZTRWADOK-DEOSSOPVSA-N |
| XLogP | 3.01 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|