C14H14FN7OS — CID 42098052
1-[(4-fluorophenyl)methyl]-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]triazole-4-carboxamide (PubChem CID 42098052) has the molecular formula C14H14FN7OS and a molecular weight of 347.38 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]triazole-4-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 42098052 |
| Molecular Formula | C14H14FN7OS |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]triazole-4-carboxamide |
| SMILES | O=C(NCCSc1cn[nH]n1)c1cn(Cc2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C14H14FN7OS/c15-11-3-1-10(2-4-11)8-22-9-12(18-21-22)14(23)16-5-6-24-13-7-17-20-19-13/h1-4,7,9H,5-6,8H2,(H,16,23)(H,17,19,20) |
| InChIKey | MWCRWZUPHJIAMZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|