C19H25Cl2N3O2S — CID 4216157
2-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(2,3-dichlorophenyl)acetamide (PubChem CID 4216157) has the molecular formula C19H25Cl2N3O2S and a molecular weight of 430.40 g/mol. Its IUPAC name is 2-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4216157 |
| Molecular Formula | C19H25Cl2N3O2S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2-(3-butyl-2-butylimino-4-oxo-1,3-thiazolidin-5-yl)-N-(2,3-dichlorophenyl)acetamide |
| SMILES | CCCC/N=C1\SC(CC(=O)Nc2cccc(Cl)c2Cl)C(=O)N1CCCC |
| InChI | InChI=1S/C19H25Cl2N3O2S/c1-3-5-10-22-19-24(11-6-4-2)18(26)15(27-19)12-16(25)23-14-9-7-8-13(20)17(14)21/h7-9,15H,3-6,10-12H2,1-2H3,(H,23,25)/b22-19- |
| InChIKey | HQGWBWGWEDJKFN-QOCHGBHMSA-N |
| XLogP | 5.22 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|