C25H35N3O3 — CID 42301357
(3R)-3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-[(2-methoxyphenyl)methyl]piperazin-2-one (PubChem CID 42301357) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is (3R)-3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-[(2-methoxyphenyl)methyl]piperazin-2-one.
| Compound Name | (3R)-3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-[(2-methoxyphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 42301357 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | (3R)-3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-[(2-methoxyphenyl)methyl]piperazin-2-one |
| SMILES | C=CCC1(CC=C)CCCCN1C(=O)C[C@@H]1C(=O)NCCN1Cc1ccccc1OC |
| InChI | InChI=1S/C25H35N3O3/c1-4-12-25(13-5-2)14-8-9-16-28(25)23(29)18-21-24(30)26-15-17-27(21)19-20-10-6-7-11-22(20)31-3/h4-7,10-11,21H,1-2,8-9,12-19H2,3H3,(H,26,30)/t21-/m1/s1 |
| InChIKey | OYUQSQHICNLSNQ-OAQYLSRUSA-N |
| XLogP | 3.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|