C23H32N4O2 — CID 45238418
3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-(pyridin-3-ylmethyl)piperazin-2-one (PubChem CID 45238418) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-(pyridin-3-ylmethyl)piperazin-2-one.
| Compound Name | 3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-(pyridin-3-ylmethyl)piperazin-2-one |
|---|---|
| PubChem CID | 45238418 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-(pyridin-3-ylmethyl)piperazin-2-one |
| SMILES | C=CCC1(CC=C)CCCCN1C(=O)CC1C(=O)NCCN1Cc1cccnc1 |
| InChI | InChI=1S/C23H32N4O2/c1-3-9-23(10-4-2)11-5-6-14-27(23)21(28)16-20-22(29)25-13-15-26(20)18-19-8-7-12-24-17-19/h3-4,7-8,12,17,20H,1-2,5-6,9-11,13-16,18H2,(H,25,29) |
| InChIKey | BFSYRYBJZBEDLL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|