C23H30FN3O2 — CID 25483038
(3R)-3-[2-[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-2-oxoethyl]-4-[(2-fluorophenyl)methyl]piperazin-2-one (PubChem CID 25483038) has the molecular formula C23H30FN3O2 and a molecular weight of 399.51 g/mol. Its IUPAC name is (3R)-3-[2-[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-2-oxoethyl]-4-[(2-fluorophenyl)methyl]piperazin-2-one.
| Compound Name | (3R)-3-[2-[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-2-oxoethyl]-4-[(2-fluorophenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 25483038 |
| Molecular Formula | C23H30FN3O2 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | (3R)-3-[2-[2,2-bis(prop-2-enyl)pyrrolidin-1-yl]-2-oxoethyl]-4-[(2-fluorophenyl)methyl]piperazin-2-one |
| SMILES | C=CCC1(CC=C)CCCN1C(=O)C[C@@H]1C(=O)NCCN1Cc1ccccc1F |
| InChI | InChI=1S/C23H30FN3O2/c1-3-10-23(11-4-2)12-7-14-27(23)21(28)16-20-22(29)25-13-15-26(20)17-18-8-5-6-9-19(18)24/h3-6,8-9,20H,1-2,7,10-17H2,(H,25,29)/t20-/m1/s1 |
| InChIKey | IPGSGLCVARKOEU-HXUWFJFHSA-N |
| XLogP | 3.03 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|