C20H33N3O4S — CID 42461404
1-[(3S)-1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidin-3-yl]ethanone (PubChem CID 42461404) has the molecular formula C20H33N3O4S and a molecular weight of 411.57 g/mol. Its IUPAC name is 1-[(3S)-1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidin-3-yl]ethanone.
| Compound Name | 1-[(3S)-1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidin-3-yl]ethanone |
|---|---|
| PubChem CID | 42461404 |
| Molecular Formula | C20H33N3O4S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-[(3S)-1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidin-3-yl]ethanone |
| SMILES | COCCCn1c(CN2CCC[C@H](C(C)=O)C2)cnc1S(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C20H33N3O4S/c1-16(24)17-7-5-10-22(14-17)15-18-13-21-20(23(18)11-6-12-27-2)28(25,26)19-8-3-4-9-19/h13,17,19H,3-12,14-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | DNKDGYRCSFRQKP-KRWDZBQOSA-N |
| XLogP | 2.44 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|