C14H17NO3S — CID 4247797
N-[3-(4-methylphenyl)sulfonyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 4247797) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is N-[3-(4-methylphenyl)sulfonyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | N-[3-(4-methylphenyl)sulfonyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 4247797 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-[3-(4-methylphenyl)sulfonyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | Cc1ccc(S(=O)(=O)C2C(=NO)C3CCC2C3)cc1 |
| InChI | InChI=1S/C14H17NO3S/c1-9-2-6-12(7-3-9)19(17,18)14-11-5-4-10(8-11)13(14)15-16/h2-3,6-7,10-11,14,16H,4-5,8H2,1H3 |
| InChIKey | YBLFXXRYJBQTEI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|