C18H9Br2ClO3 — CID 42533826
6,8-dibromo-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]chromen-2-one (PubChem CID 42533826) has the molecular formula C18H9Br2ClO3 and a molecular weight of 468.53 g/mol. Its IUPAC name is 6,8-dibromo-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]chromen-2-one.
| Compound Name | 6,8-dibromo-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]chromen-2-one |
|---|---|
| PubChem CID | 42533826 |
| Molecular Formula | C18H9Br2ClO3 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 465.86 |
| IUPAC Name | 6,8-dibromo-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]chromen-2-one |
| SMILES | O=C(/C=C/c1ccccc1Cl)c1cc2cc(Br)cc(Br)c2oc1=O |
| InChI | InChI=1S/C18H9Br2ClO3/c19-12-7-11-8-13(18(23)24-17(11)14(20)9-12)16(22)6-5-10-3-1-2-4-15(10)21/h1-9H/b6-5+ |
| InChIKey | PEFHOUQLJSKOGD-AATRIKPKSA-N |
| XLogP | 5.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|