C26H32N4OS — CID 4254228
1-[[1-[2-(4-tert-butylphenoxy)ethyl]-2-methylindol-3-yl]methylideneamino]-3-prop-2-enylthiourea (PubChem CID 4254228) has the molecular formula C26H32N4OS and a molecular weight of 448.64 g/mol. Its IUPAC name is 1-[[1-[2-(4-tert-butylphenoxy)ethyl]-2-methylindol-3-yl]methylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[[1-[2-(4-tert-butylphenoxy)ethyl]-2-methylindol-3-yl]methylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 4254228 |
| Molecular Formula | C26H32N4OS |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-[[1-[2-(4-tert-butylphenoxy)ethyl]-2-methylindol-3-yl]methylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NN=Cc1c(C)n(CCOc2ccc(C(C)(C)C)cc2)c2ccccc12 |
| InChI | InChI=1S/C26H32N4OS/c1-6-15-27-25(32)29-28-18-23-19(2)30(24-10-8-7-9-22(23)24)16-17-31-21-13-11-20(12-14-21)26(3,4)5/h6-14,18H,1,15-17H2,2-5H3,(H2,27,29,32) |
| InChIKey | QWTWPCQXMXSMLY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 50.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|