C21H29FN2OS — CID 42570972
(4aS,8aR)-1-[2-(4-fluorophenyl)ethyl]-8a-hydroxyspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione (PubChem CID 42570972) has the molecular formula C21H29FN2OS and a molecular weight of 376.54 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(4-fluorophenyl)ethyl]-8a-hydroxyspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione.
| Compound Name | (4aS,8aR)-1-[2-(4-fluorophenyl)ethyl]-8a-hydroxyspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione |
|---|---|
| PubChem CID | 42570972 |
| Molecular Formula | C21H29FN2OS |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (4aS,8aR)-1-[2-(4-fluorophenyl)ethyl]-8a-hydroxyspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione |
| SMILES | O[C@]12CCCC[C@H]1C1(CCCCC1)NC(=S)N2CCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H29FN2OS/c22-17-9-7-16(8-10-17)11-15-24-19(26)23-20(12-3-1-4-13-20)18-6-2-5-14-21(18,24)25/h7-10,18,25H,1-6,11-15H2,(H,23,26)/t18-,21+/m0/s1 |
| InChIKey | CMCSTRPAGBNPKS-GHTZIAJQSA-N |
| XLogP | 4.14 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|