C11H13NO2S — CID 42583511
1,2-diethoxy-4-isothiocyanatobenzene (PubChem CID 42583511) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 1,2-diethoxy-4-isothiocyanatobenzene.
| Compound Name | 1,2-diethoxy-4-isothiocyanatobenzene |
|---|---|
| PubChem CID | 42583511 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 1,2-diethoxy-4-isothiocyanatobenzene |
| SMILES | CCOc1ccc(N=C=S)cc1OCC |
| InChI | InChI=1S/C11H13NO2S/c1-3-13-10-6-5-9(12-8-15)7-11(10)14-4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | PLTVHLUAEIEQKO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|