C18H18N2OS — CID 42589555
2-thiophen-2-yl-N-(2,6,8-trimethylquinolin-4-yl)acetamide (PubChem CID 42589555) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-thiophen-2-yl-N-(2,6,8-trimethylquinolin-4-yl)acetamide.
| Compound Name | 2-thiophen-2-yl-N-(2,6,8-trimethylquinolin-4-yl)acetamide |
|---|---|
| PubChem CID | 42589555 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-thiophen-2-yl-N-(2,6,8-trimethylquinolin-4-yl)acetamide |
| SMILES | Cc1cc(C)c2nc(C)cc(NC(=O)Cc3cccs3)c2c1 |
| InChI | InChI=1S/C18H18N2OS/c1-11-7-12(2)18-15(8-11)16(9-13(3)19-18)20-17(21)10-14-5-4-6-22-14/h4-9H,10H2,1-3H3,(H,19,20,21) |
| InChIKey | NFFNUBPNYLHYOW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |