C14H19NO6S — CID 42603887
[1-[(1S)-2-hydroxy-1-(phenylmethoxycarbonylamino)ethyl]cyclopropyl] methanesulfonate (PubChem CID 42603887) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is [1-[(1S)-2-hydroxy-1-(phenylmethoxycarbonylamino)ethyl]cyclopropyl] methanesulfonate.
| Compound Name | [1-[(1S)-2-hydroxy-1-(phenylmethoxycarbonylamino)ethyl]cyclopropyl] methanesulfonate |
|---|---|
| PubChem CID | 42603887 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [1-[(1S)-2-hydroxy-1-(phenylmethoxycarbonylamino)ethyl]cyclopropyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1([C@H](CO)NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C14H19NO6S/c1-22(18,19)21-14(7-8-14)12(9-16)15-13(17)20-10-11-5-3-2-4-6-11/h2-6,12,16H,7-10H2,1H3,(H,15,17)/t12-/m0/s1 |
| InChIKey | VIXXWGBDNUYYTN-LBPRGKRZSA-N |
| XLogP | 0.78 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|