C18H15ClN2O3S — CID 42604119
O-[(2S)-2-(1,3-dioxoisoindol-2-yl)propyl] N-(4-chlorophenyl)carbamothioate (PubChem CID 42604119) has the molecular formula C18H15ClN2O3S and a molecular weight of 374.85 g/mol. Its IUPAC name is O-[(2S)-2-(1,3-dioxoisoindol-2-yl)propyl] N-(4-chlorophenyl)carbamothioate.
| Compound Name | O-[(2S)-2-(1,3-dioxoisoindol-2-yl)propyl] N-(4-chlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 42604119 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | O-[(2S)-2-(1,3-dioxoisoindol-2-yl)propyl] N-(4-chlorophenyl)carbamothioate |
| SMILES | C[C@@H](COC(=S)Nc1ccc(Cl)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H15ClN2O3S/c1-11(10-24-18(25)20-13-8-6-12(19)7-9-13)21-16(22)14-4-2-3-5-15(14)17(21)23/h2-9,11H,10H2,1H3,(H,20,25)/t11-/m0/s1 |
| InChIKey | QXEZAPCABUYZLP-NSHDSACASA-N |
| XLogP | 3.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|