C13H13N3O — CID 42611542
(1R,10R)-11-oxa-15,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13,15-pentaene (PubChem CID 42611542) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is (1R,10R)-11-oxa-15,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13,15-pentaene.
| Compound Name | (1R,10R)-11-oxa-15,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13,15-pentaene |
|---|---|
| PubChem CID | 42611542 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (1R,10R)-11-oxa-15,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13,15-pentaene |
| SMILES | c1ccc2c(c1)CC[C@H]1OCc3cnnn3[C@H]21 |
| InChI | InChI=1S/C13H13N3O/c1-2-4-11-9(3-1)5-6-12-13(11)16-10(8-17-12)7-14-15-16/h1-4,7,12-13H,5-6,8H2/t12-,13-/m1/s1 |
| InChIKey | APYJKSRJVMOJFX-CHWSQXEVSA-N |
| XLogP | 1.71 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |