C29H33NO — CID 42612178
(2R,3R,6R,7R)-3-benzyl-4-(dimethylamino)-6,7-diphenylbicyclo[2.2.2]octan-2-ol (PubChem CID 42612178) has the molecular formula C29H33NO and a molecular weight of 411.59 g/mol. Its IUPAC name is (2R,3R,6R,7R)-3-benzyl-4-(dimethylamino)-6,7-diphenylbicyclo[2.2.2]octan-2-ol.
| Compound Name | (2R,3R,6R,7R)-3-benzyl-4-(dimethylamino)-6,7-diphenylbicyclo[2.2.2]octan-2-ol |
|---|---|
| PubChem CID | 42612178 |
| Molecular Formula | C29H33NO |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | (2R,3R,6R,7R)-3-benzyl-4-(dimethylamino)-6,7-diphenylbicyclo[2.2.2]octan-2-ol |
| SMILES | CN(C)C12C[C@@H](c3ccccc3)C([C@@H](O)[C@@H]1Cc1ccccc1)[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C29H33NO/c1-30(2)29-19-24(22-14-8-4-9-15-22)27(25(20-29)23-16-10-5-11-17-23)28(31)26(29)18-21-12-6-3-7-13-21/h3-17,24-28,31H,18-20H2,1-2H3/t24-,25-,26-,27?,28-,29?/m0/s1 |
| InChIKey | IWKLCEIVNPNNPH-JBOFUENOSA-N |
| XLogP | 5.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |