C24H31NO — CID 11279529
(2R,6R,7R)-4-(diethylamino)-6,7-diphenylbicyclo[2.2.2]octan-2-ol (PubChem CID 11279529) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is (2R,6R,7R)-4-(diethylamino)-6,7-diphenylbicyclo[2.2.2]octan-2-ol.
| Compound Name | (2R,6R,7R)-4-(diethylamino)-6,7-diphenylbicyclo[2.2.2]octan-2-ol |
|---|---|
| PubChem CID | 11279529 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | (2R,6R,7R)-4-(diethylamino)-6,7-diphenylbicyclo[2.2.2]octan-2-ol |
| SMILES | CCN(CC)C12C[C@@H](O)C([C@H](c3ccccc3)C1)[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C24H31NO/c1-3-25(4-2)24-15-20(18-11-7-5-8-12-18)23(22(26)17-24)21(16-24)19-13-9-6-10-14-19/h5-14,20-23,26H,3-4,15-17H2,1-2H3/t20-,21-,22+,23?,24?/m0/s1 |
| InChIKey | CRFPEYIUQXMPAR-WZLDUSJXSA-N |
| XLogP | 4.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |