C18H38OSi — CID 42612432
tert-butyl-dimethyl-[(3S,4R,5R,7R)-3,5,7-trimethylnon-1-en-4-yl]oxysilane (PubChem CID 42612432) has the molecular formula C18H38OSi and a molecular weight of 298.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,4R,5R,7R)-3,5,7-trimethylnon-1-en-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S,4R,5R,7R)-3,5,7-trimethylnon-1-en-4-yl]oxysilane |
|---|---|
| PubChem CID | 42612432 |
| Molecular Formula | C18H38OSi |
| Molecular Weight | 298.59 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,4R,5R,7R)-3,5,7-trimethylnon-1-en-4-yl]oxysilane |
| SMILES | C=C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@H](C)CC |
| InChI | InChI=1S/C18H38OSi/c1-11-14(3)13-16(5)17(15(4)12-2)19-20(9,10)18(6,7)8/h12,14-17H,2,11,13H2,1,3-10H3/t14-,15+,16-,17+/m1/s1 |
| InChIKey | VBEKAMLHELSIHC-TWMKSMIVSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|