C17H23N3O7 — CID 42627784
[[(3R,4R,5S,6S)-3-(butanoylamino)-6-formyl-4,5-dihydroxyoxan-2-yl]amino] N-phenylcarbamate (PubChem CID 42627784) has the molecular formula C17H23N3O7 and a molecular weight of 381.39 g/mol. Its IUPAC name is [[(3R,4R,5S,6S)-3-(butanoylamino)-6-formyl-4,5-dihydroxyoxan-2-yl]amino] N-phenylcarbamate.
| Compound Name | [[(3R,4R,5S,6S)-3-(butanoylamino)-6-formyl-4,5-dihydroxyoxan-2-yl]amino] N-phenylcarbamate |
|---|---|
| PubChem CID | 42627784 |
| Molecular Formula | C17H23N3O7 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | [[(3R,4R,5S,6S)-3-(butanoylamino)-6-formyl-4,5-dihydroxyoxan-2-yl]amino] N-phenylcarbamate |
| SMILES | CCCC(=O)N[C@H]1C(NOC(=O)Nc2ccccc2)O[C@H](C=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H23N3O7/c1-2-6-12(22)19-13-15(24)14(23)11(9-21)26-16(13)20-27-17(25)18-10-7-4-3-5-8-10/h3-5,7-9,11,13-16,20,23-24H,2,6H2,1H3,(H,18,25)(H,19,22)/t11-,13-,14-,15-,16?/m1/s1 |
| InChIKey | ALZPOLWNERMWMF-ALTVCHKUSA-N |
| XLogP | -0.33 |
| TPSA | 146.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|