C34H37N3O8 — CID 42627817
ethyl 6-(4,5-dimethoxy-2-nitrophenyl)-4-methyl-2-oxo-3-[[(2S,5S)-5-[(4-phenylphenyl)methyl]oxolan-2-yl]methyl]-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 42627817) has the molecular formula C34H37N3O8 and a molecular weight of 615.68 g/mol. Its IUPAC name is ethyl 6-(4,5-dimethoxy-2-nitrophenyl)-4-methyl-2-oxo-3-[[(2S,5S)-5-[(4-phenylphenyl)methyl]oxolan-2-yl]methyl]-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-(4,5-dimethoxy-2-nitrophenyl)-4-methyl-2-oxo-3-[[(2S,5S)-5-[(4-phenylphenyl)methyl]oxolan-2-yl]methyl]-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 42627817 |
| Molecular Formula | C34H37N3O8 |
| Molecular Weight | 615.68 g/mol |
| Exact Mass | 615.26 |
| IUPAC Name | ethyl 6-(4,5-dimethoxy-2-nitrophenyl)-4-methyl-2-oxo-3-[[(2S,5S)-5-[(4-phenylphenyl)methyl]oxolan-2-yl]methyl]-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(C[C@@H]2CC[C@@H](Cc3ccc(-c4ccccc4)cc3)O2)C(=O)NC1c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C34H37N3O8/c1-5-44-33(38)31-21(2)36(34(39)35-32(31)27-18-29(42-3)30(43-4)19-28(27)37(40)41)20-26-16-15-25(45-26)17-22-11-13-24(14-12-22)23-9-7-6-8-10-23/h6-14,18-19,25-26,32H,5,15-17,20H2,1-4H3,(H,35,39)/t25-,26-,32?/m0/s1 |
| InChIKey | YLEWHBCONZYAAQ-URFMBUMFSA-N |
| XLogP | 5.97 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.68 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|