C18H24ClN5 — CID 42633171
1-[(E)-[1-(4-chlorophenyl)pyrrol-2-yl]methylideneamino]-2-hexylguanidine (PubChem CID 42633171) has the molecular formula C18H24ClN5 and a molecular weight of 345.88 g/mol. Its IUPAC name is 1-[(E)-[1-(4-chlorophenyl)pyrrol-2-yl]methylideneamino]-2-hexylguanidine.
| Compound Name | 1-[(E)-[1-(4-chlorophenyl)pyrrol-2-yl]methylideneamino]-2-hexylguanidine |
|---|---|
| PubChem CID | 42633171 |
| Molecular Formula | C18H24ClN5 |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[(E)-[1-(4-chlorophenyl)pyrrol-2-yl]methylideneamino]-2-hexylguanidine |
| SMILES | CCCCCC/N=C(\N)N/N=C/c1cccn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClN5/c1-2-3-4-5-12-21-18(20)23-22-14-17-7-6-13-24(17)16-10-8-15(19)9-11-16/h6-11,13-14H,2-5,12H2,1H3,(H3,20,21,23)/b22-14+ |
| InChIKey | WLICPSVNWGUYAG-HYARGMPZSA-N |
| XLogP | 3.95 |
| TPSA | 67.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|