C20H30O8 — CID 42636275
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl 2-ethylhexanoate (PubChem CID 42636275) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl 2-ethylhexanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl 2-ethylhexanoate |
|---|---|
| PubChem CID | 42636275 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OC[C@H]1O[C@@H](Oc2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H30O8/c1-3-5-6-12(4-2)19(25)26-11-15-16(22)17(23)18(24)20(28-15)27-14-9-7-13(21)8-10-14/h7-10,12,15-18,20-24H,3-6,11H2,1-2H3/t12?,15-,16-,17+,18-,20-/m1/s1 |
| InChIKey | QLSMRKPXTFSRLZ-WJXCIPQMSA-N |
| XLogP | 1.34 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |