C33H40N2O4 — CID 42638068
ethyl 7-[[1-(benzylamino)-1-oxo-3-phenylpropan-2-yl]-(2-phenylethyl)amino]-7-oxoheptanoate (PubChem CID 42638068) has the molecular formula C33H40N2O4 and a molecular weight of 528.69 g/mol. Its IUPAC name is ethyl 7-[[1-(benzylamino)-1-oxo-3-phenylpropan-2-yl]-(2-phenylethyl)amino]-7-oxoheptanoate.
| Compound Name | ethyl 7-[[1-(benzylamino)-1-oxo-3-phenylpropan-2-yl]-(2-phenylethyl)amino]-7-oxoheptanoate |
|---|---|
| PubChem CID | 42638068 |
| Molecular Formula | C33H40N2O4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | ethyl 7-[[1-(benzylamino)-1-oxo-3-phenylpropan-2-yl]-(2-phenylethyl)amino]-7-oxoheptanoate |
| SMILES | CCOC(=O)CCCCCC(=O)N(CCc1ccccc1)C(Cc1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H40N2O4/c1-2-39-32(37)22-14-6-13-21-31(36)35(24-23-27-15-7-3-8-16-27)30(25-28-17-9-4-10-18-28)33(38)34-26-29-19-11-5-12-20-29/h3-5,7-12,15-20,30H,2,6,13-14,21-26H2,1H3,(H,34,38) |
| InChIKey | XIIBYMINMIEOSU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|