C31H30N4O3 — CID 42665803
3-[1-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 42665803) has the molecular formula C31H30N4O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is 3-[1-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 42665803 |
| Molecular Formula | C31H30N4O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 3-[1-[1-(3-methoxyphenyl)-2-methyl-5-phenylpyrrole-3-carbonyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | COc1cccc(-n2c(-c3ccccc3)cc(C(=O)N3CCC(n4c(=O)[nH]c5ccccc54)CC3)c2C)c1 |
| InChI | InChI=1S/C31H30N4O3/c1-21-26(20-29(22-9-4-3-5-10-22)34(21)24-11-8-12-25(19-24)38-2)30(36)33-17-15-23(16-18-33)35-28-14-7-6-13-27(28)32-31(35)37/h3-14,19-20,23H,15-18H2,1-2H3,(H,32,37) |
| InChIKey | RZRIDVJVCBFNTO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|