C20H23FN4O4S — CID 4267851
(2-oxo-2-piperidin-1-ylethyl) N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 4267851) has the molecular formula C20H23FN4O4S and a molecular weight of 434.49 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 4267851 |
| Molecular Formula | C20H23FN4O4S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | Cn1c(O)c(/C(=N/c2ccc(F)cc2)SCC(=O)N2CCCCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C20H23FN4O4S/c1-23-18(27)16(19(28)24(2)20(23)29)17(22-14-8-6-13(21)7-9-14)30-12-15(26)25-10-4-3-5-11-25/h6-9,27H,3-5,10-12H2,1-2H3/b22-17- |
| InChIKey | DKWQZSXZKNLMHN-XLNRJJMWSA-N |
| XLogP | 1.75 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|