C28H41N3O2 — CID 42704873
N-[3-(1H-indol-3-yl)-1-oxo-1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)propan-2-yl]heptanamide (PubChem CID 42704873) has the molecular formula C28H41N3O2 and a molecular weight of 451.66 g/mol. Its IUPAC name is N-[3-(1H-indol-3-yl)-1-oxo-1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)propan-2-yl]heptanamide.
| Compound Name | N-[3-(1H-indol-3-yl)-1-oxo-1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)propan-2-yl]heptanamide |
|---|---|
| PubChem CID | 42704873 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | N-[3-(1H-indol-3-yl)-1-oxo-1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)propan-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)N1CC2(C)CC1CC(C)(C)C2 |
| InChI | InChI=1S/C28H41N3O2/c1-5-6-7-8-13-25(32)30-24(14-20-17-29-23-12-10-9-11-22(20)23)26(33)31-19-28(4)16-21(31)15-27(2,3)18-28/h9-12,17,21,24,29H,5-8,13-16,18-19H2,1-4H3,(H,30,32) |
| InChIKey | YSPRXMQFGYJMIU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|