C12H11N5O3S — CID 4270853
4-[(2-amino-6-oxo-1H-pyrimidin-5-yl)carbamothioylamino]benzoic acid (PubChem CID 4270853) has the molecular formula C12H11N5O3S and a molecular weight of 305.32 g/mol. Its IUPAC name is 4-[(2-amino-6-oxo-1H-pyrimidin-5-yl)carbamothioylamino]benzoic acid.
| Compound Name | 4-[(2-amino-6-oxo-1H-pyrimidin-5-yl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 4270853 |
| Molecular Formula | C12H11N5O3S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-[(2-amino-6-oxo-1H-pyrimidin-5-yl)carbamothioylamino]benzoic acid |
| SMILES | Nc1ncc(NC(=S)Nc2ccc(C(=O)O)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H11N5O3S/c13-11-14-5-8(9(18)17-11)16-12(21)15-7-3-1-6(2-4-7)10(19)20/h1-5H,(H,19,20)(H2,15,16,21)(H3,13,14,17,18) |
| InChIKey | BJKCORPTJXNGHT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|