About [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate
[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate (PubChem CID 42726984) has the molecular formula C22H20FN3O3S
and a molecular weight of 425.49 g/mol. Its IUPAC name is [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate.
Molecular Properties
| Compound Name | [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate |
| PubChem CID | 42726984 |
| Molecular Formula | C22H20FN3O3S |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate |
| SMILES | CC(C)(C)c1cc(OS(=O)(=O)c2cccc3cccnc23)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H20FN3O3S/c1-22(2,3)19-14-20(26(25-19)17-11-9-16(23)10-12-17)29-30(27,28)18-8-4-6-15-7-5-13-24-21(15)18/h4-14H,1-3H3 |
| InChIKey | UBLSYBOFUVBGIO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate?
The IUPAC name of [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate (CID 42726984) is [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate.
What is the SMILES notation for [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate?
The canonical SMILES for [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate is CC(C)(C)c1cc(OS(=O)(=O)c2cccc3cccnc23)n(-c2ccc(F)cc2)n1.
What is the InChIKey of [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate?
The InChIKey is UBLSYBOFUVBGIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FN3O3S/c1-22(2,3)19-14-20(26(25-19)17-11-9-16(23)10-12-17)29-30(27,28)18-8-4-6-15-7-5-13-24-21(15)18/h4-14H,1-3H3.
What are the key properties of [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate?
[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate has a molecular weight of 425.49 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl] quinoline-8-sulfonate is sourced from PubChem (CID 42726984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).