C22H34N2O3S — CID 42658017
[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl] octane-1-sulfonate (PubChem CID 42658017) has the molecular formula C22H34N2O3S and a molecular weight of 406.59 g/mol. Its IUPAC name is [3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl] octane-1-sulfonate.
| Compound Name | [3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl] octane-1-sulfonate |
|---|---|
| PubChem CID | 42658017 |
| Molecular Formula | C22H34N2O3S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl] octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)Oc1cc(C(C)(C)C)nn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C22H34N2O3S/c1-6-7-8-9-10-11-16-28(25,26)27-21-17-20(22(3,4)5)23-24(21)19-14-12-18(2)13-15-19/h12-15,17H,6-11,16H2,1-5H3 |
| InChIKey | JAAZCTDZRYYEFY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|