C27H35N3O — CID 42732625
N-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-4-hexylbenzamide (PubChem CID 42732625) has the molecular formula C27H35N3O and a molecular weight of 417.60 g/mol. Its IUPAC name is N-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-4-hexylbenzamide.
| Compound Name | N-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-4-hexylbenzamide |
|---|---|
| PubChem CID | 42732625 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | N-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-4-hexylbenzamide |
| SMILES | CCCCCCc1ccc(C(=O)Nc2cc(C(C)(C)C)nn2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H35N3O/c1-6-7-8-9-10-21-13-15-22(16-14-21)26(31)28-25-19-24(27(3,4)5)29-30(25)23-17-11-20(2)12-18-23/h11-19H,6-10H2,1-5H3,(H,28,31) |
| InChIKey | RLUOVWMKDATYLW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|