C36H44N4O2 — CID 98402824
N-[(2S)-1-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-hexylbenzamide (PubChem CID 98402824) has the molecular formula C36H44N4O2 and a molecular weight of 564.77 g/mol. Its IUPAC name is N-[(2S)-1-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-hexylbenzamide.
| Compound Name | N-[(2S)-1-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-hexylbenzamide |
|---|---|
| PubChem CID | 98402824 |
| Molecular Formula | C36H44N4O2 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.35 |
| IUPAC Name | N-[(2S)-1-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-hexylbenzamide |
| SMILES | CCCCCCc1ccc(C(=O)N[C@@H](Cc2ccccc2)C(=O)Nc2cc(C(C)(C)C)nn2-c2ccccc2C)cc1 |
| InChI | InChI=1S/C36H44N4O2/c1-6-7-8-10-16-27-20-22-29(23-21-27)34(41)37-30(24-28-17-11-9-12-18-28)35(42)38-33-25-32(36(3,4)5)39-40(33)31-19-14-13-15-26(31)2/h9,11-15,17-23,25,30H,6-8,10,16,24H2,1-5H3,(H,37,41)(H,38,42)/t30-/m0/s1 |
| InChIKey | JGYFDSXCZMRGFR-PMERELPUSA-N |
| XLogP | 7.58 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|