C15H17F3N2O3S — CID 42728134
[1-(3-methylphenyl)-3-(trifluoromethyl)pyrazol-5-yl] butane-1-sulfonate (PubChem CID 42728134) has the molecular formula C15H17F3N2O3S and a molecular weight of 362.37 g/mol. Its IUPAC name is [1-(3-methylphenyl)-3-(trifluoromethyl)pyrazol-5-yl] butane-1-sulfonate.
| Compound Name | [1-(3-methylphenyl)-3-(trifluoromethyl)pyrazol-5-yl] butane-1-sulfonate |
|---|---|
| PubChem CID | 42728134 |
| Molecular Formula | C15H17F3N2O3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [1-(3-methylphenyl)-3-(trifluoromethyl)pyrazol-5-yl] butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)Oc1cc(C(F)(F)F)nn1-c1cccc(C)c1 |
| InChI | InChI=1S/C15H17F3N2O3S/c1-3-4-8-24(21,22)23-14-10-13(15(16,17)18)19-20(14)12-7-5-6-11(2)9-12/h5-7,9-10H,3-4,8H2,1-2H3 |
| InChIKey | ALXNXZDVBAKHMK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|