C27H31N3O3 — CID 42764519
6-amino-N-[1-oxo-1-(2-phenoxyanilino)-3-phenylpropan-2-yl]hexanamide (PubChem CID 42764519) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is 6-amino-N-[1-oxo-1-(2-phenoxyanilino)-3-phenylpropan-2-yl]hexanamide.
| Compound Name | 6-amino-N-[1-oxo-1-(2-phenoxyanilino)-3-phenylpropan-2-yl]hexanamide |
|---|---|
| PubChem CID | 42764519 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 6-amino-N-[1-oxo-1-(2-phenoxyanilino)-3-phenylpropan-2-yl]hexanamide |
| SMILES | NCCCCCC(=O)NC(Cc1ccccc1)C(=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C27H31N3O3/c28-19-11-3-8-18-26(31)29-24(20-21-12-4-1-5-13-21)27(32)30-23-16-9-10-17-25(23)33-22-14-6-2-7-15-22/h1-2,4-7,9-10,12-17,24H,3,8,11,18-20,28H2,(H,29,31)(H,30,32) |
| InChIKey | QHLKIOWIKSKPKA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|