C20H26N2O3 — CID 42789526
N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxamide (PubChem CID 42789526) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 42789526 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5-dimethyl-1-prop-2-enylpyrrole-2-carboxamide |
| SMILES | C=CCn1c(C)cc(C)c1C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H26N2O3/c1-6-11-22-15(3)12-14(2)19(22)20(23)21-10-9-16-7-8-17(24-4)18(13-16)25-5/h6-8,12-13H,1,9-11H2,2-5H3,(H,21,23) |
| InChIKey | FIGFDKCTIGJIME-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|