C18H19FN4O2 — CID 42798787
3-[3-(2-ethoxyethoxy)-5-(4-fluorophenyl)-1,2,4-triazol-1-yl]aniline (PubChem CID 42798787) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is 3-[3-(2-ethoxyethoxy)-5-(4-fluorophenyl)-1,2,4-triazol-1-yl]aniline.
| Compound Name | 3-[3-(2-ethoxyethoxy)-5-(4-fluorophenyl)-1,2,4-triazol-1-yl]aniline |
|---|---|
| PubChem CID | 42798787 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 3-[3-(2-ethoxyethoxy)-5-(4-fluorophenyl)-1,2,4-triazol-1-yl]aniline |
| SMILES | CCOCCOc1nc(-c2ccc(F)cc2)n(-c2cccc(N)c2)n1 |
| InChI | InChI=1S/C18H19FN4O2/c1-2-24-10-11-25-18-21-17(13-6-8-14(19)9-7-13)23(22-18)16-5-3-4-15(20)12-16/h3-9,12H,2,10-11,20H2,1H3 |
| InChIKey | XDOSSRQVCPKZCK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|