C19H20N2O6S — CID 42806006
3-(2,4-dimethoxyphenyl)-6,7,8-trimethoxy-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 42806006) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-6,7,8-trimethoxy-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-(2,4-dimethoxyphenyl)-6,7,8-trimethoxy-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 42806006 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-6,7,8-trimethoxy-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | COc1ccc(-n2c(=S)[nH]c3c(OC)c(OC)c(OC)cc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C19H20N2O6S/c1-23-10-6-7-12(13(8-10)24-2)21-18(22)11-9-14(25-3)16(26-4)17(27-5)15(11)20-19(21)28/h6-9H,1-5H3,(H,20,28) |
| InChIKey | NHHCYYWOGZOUNS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|