C11H12N2O3S — CID 114588841
6,8-dimethoxy-3-methyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 114588841) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 6,8-dimethoxy-3-methyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 6,8-dimethoxy-3-methyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 114588841 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 6,8-dimethoxy-3-methyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | COc1cc(OC)c2[nH]c(=S)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C11H12N2O3S/c1-13-10(14)7-4-6(15-2)5-8(16-3)9(7)12-11(13)17/h4-5H,1-3H3,(H,12,17) |
| InChIKey | ICIXQSVEYDDMKR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|